C7H17IO7 — CID 126649290
heptane-1,2,3,4,5,6,7-heptol;hydroiodide (PubChem CID 126649290) has the molecular formula C7H17IO7 and a molecular weight of 340.11 g/mol. Its IUPAC name is heptane-1,2,3,4,5,6,7-heptol;hydroiodide.
| Compound Name | heptane-1,2,3,4,5,6,7-heptol;hydroiodide |
|---|---|
| PubChem CID | 126649290 |
| Molecular Formula | C7H17IO7 |
| Molecular Weight | 340.11 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | heptane-1,2,3,4,5,6,7-heptol;hydroiodide |
| SMILES | I.OCC(O)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C7H16O7.HI/c8-1-3(10)5(12)7(14)6(13)4(11)2-9;/h3-14H,1-2H2;1H |
| InChIKey | QZNJFNGOOSYURX-UHFFFAOYSA-N |
| XLogP | -3.61 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.11 |
| LogP ≤ 5 | -3.61 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|