C6H14Fe27O6 — CID 173421469
(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;iron (PubChem CID 173421469) has the molecular formula C6H14Fe27O6 and a molecular weight of 1689.99 g/mol. Its IUPAC name is (2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;iron.
| Compound Name | (2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;iron |
|---|---|
| PubChem CID | 173421469 |
| Molecular Formula | C6H14Fe27O6 |
| Molecular Weight | 1689.99 g/mol |
| Exact Mass | 1692.32 |
| IUPAC Name | (2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;iron |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO.[Fe].[Fe].[Fe].[Fe].[Fe].[Fe].[Fe].[Fe].[Fe].[Fe].[Fe].[Fe].[Fe].[Fe].[Fe].[Fe].[Fe].[Fe].[Fe].[Fe].[Fe].[Fe].[Fe].[Fe].[Fe].[Fe].[Fe] |
| InChI | InChI=1S/C6H14O6.27Fe/c7-1-3(9)5(11)6(12)4(10)2-8;;;;;;;;;;;;;;;;;;;;;;;;;;;/h3-12H,1-2H2;;;;;;;;;;;;;;;;;;;;;;;;;;;/t3-,4+,5-,6-;;;;;;;;;;;;;;;;;;;;;;;;;;;/m1.........................../s1 |
| InChIKey | WBJASKBNDQYRGP-GOPCPQCNSA-N |
| XLogP | -3.65 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1689.99 |
| LogP ≤ 5 | -3.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|