C6H15LiO6 — CID 173340002
lithium;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;hydride (PubChem CID 173340002) has the molecular formula C6H15LiO6 and a molecular weight of 190.12 g/mol. Its IUPAC name is lithium;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;hydride.
| Compound Name | lithium;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;hydride |
|---|---|
| PubChem CID | 173340002 |
| Molecular Formula | C6H15LiO6 |
| Molecular Weight | 190.12 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | lithium;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;hydride |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO.[H-].[Li+] |
| InChI | InChI=1S/C6H14O6.Li.H/c7-1-3(9)5(11)6(12)4(10)2-8;;/h3-12H,1-2H2;;/q;+1;-1/t3-,4+,5-,6-;;/m1../s1 |
| InChIKey | XTLRYDWXNNPUSF-MGXNYLRYSA-N |
| XLogP | -6.47 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.12 |
| LogP ≤ 5 | -6.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |