C7H16O6 — CID 88922638
heptane-1,2,3,4,5,7-hexol (PubChem CID 88922638) has the molecular formula C7H16O6 and a molecular weight of 196.20 g/mol. Its IUPAC name is heptane-1,2,3,4,5,7-hexol.
| Compound Name | heptane-1,2,3,4,5,7-hexol |
|---|---|
| PubChem CID | 88922638 |
| Molecular Formula | C7H16O6 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | heptane-1,2,3,4,5,7-hexol |
| SMILES | OCCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C7H16O6/c8-2-1-4(10)6(12)7(13)5(11)3-9/h4-13H,1-3H2 |
| InChIKey | WLPYQKQYRMDUME-UHFFFAOYSA-N |
| XLogP | -3.20 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |