C14H34O10 — CID 134284042
bis(butane-1,4-diol);hexane-1,2,3,4,5,6-hexol (PubChem CID 134284042) has the molecular formula C14H34O10 and a molecular weight of 362.42 g/mol. Its IUPAC name is bis(butane-1,4-diol);hexane-1,2,3,4,5,6-hexol.
| Compound Name | bis(butane-1,4-diol);hexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 134284042 |
| Molecular Formula | C14H34O10 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | bis(butane-1,4-diol);hexane-1,2,3,4,5,6-hexol |
| SMILES | OCC(O)C(O)C(O)C(O)CO.OCCCCO.OCCCCO |
| InChI | InChI=1S/C6H14O6.2C4H10O2/c7-1-3(9)5(11)6(12)4(10)2-8;2*5-3-1-2-4-6/h3-12H,1-2H2;2*5-6H,1-4H2 |
| InChIKey | FQJSGRGZFJMSNC-UHFFFAOYSA-N |
| XLogP | -4.08 |
| TPSA | 202.30 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | -4.08 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|