About CID 87266813
CID 87266813 (PubChem CID 87266813) has the molecular formula C6H14KO6
and a molecular weight of 221.27 g/mol.
Molecular Properties
| Compound Name | CID 87266813 |
| PubChem CID | 87266813 |
| Molecular Formula | C6H14KO6 |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | — |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO.[K] |
| InChI | InChI=1S/C6H14O6.K/c7-1-3(9)5(11)6(12)4(10)2-8;/h3-12H,1-2H2;/t3-,4+,5-,6-;/m1./s1 |
| InChIKey | FBWXMTQQIWGGKY-VFQQELCFSA-N |
| XLogP | -3.97 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | -3.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 87266813 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87266813?
The IUPAC name of CID 87266813 (CID 87266813) is not available.
What is the SMILES notation for CID 87266813?
The canonical SMILES for CID 87266813 is OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO.[K].
What is the InChIKey of CID 87266813?
The InChIKey is FBWXMTQQIWGGKY-VFQQELCFSA-N. The full InChI is InChI=1S/C6H14O6.K/c7-1-3(9)5(11)6(12)4(10)2-8;/h3-12H,1-2H2;/t3-,4+,5-,6-;/m1./s1.
What are the key properties of CID 87266813?
CID 87266813 has a molecular weight of 221.27 g/mol, XLogP of -3.97, 5 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87266813 is sourced from PubChem (CID 87266813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).