C7H18O7 — CID 174767977
hexane-1,2,3,4,5,6-hexol;methanol (PubChem CID 174767977) has the molecular formula C7H18O7 and a molecular weight of 214.21 g/mol. Its IUPAC name is hexane-1,2,3,4,5,6-hexol;methanol.
| Compound Name | hexane-1,2,3,4,5,6-hexol;methanol |
|---|---|
| PubChem CID | 174767977 |
| Molecular Formula | C7H18O7 |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | hexane-1,2,3,4,5,6-hexol;methanol |
| SMILES | CO.OCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H14O6.CH4O/c7-1-3(9)5(11)6(12)4(10)2-8;1-2/h3-12H,1-2H2;2H,1H3 |
| InChIKey | NIAPOWPJCZVFPB-UHFFFAOYSA-N |
| XLogP | -3.98 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.21 |
| LogP ≤ 5 | -3.98 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |