C8H16O5 — CID 134906193
(2R,3R,4R)-oct-7-ene-1,2,3,4,5-pentol (PubChem CID 134906193) has the molecular formula C8H16O5 and a molecular weight of 192.21 g/mol. Its IUPAC name is (2R,3R,4R)-oct-7-ene-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R)-oct-7-ene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 134906193 |
| Molecular Formula | C8H16O5 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | (2R,3R,4R)-oct-7-ene-1,2,3,4,5-pentol |
| SMILES | C=CCC(O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H16O5/c1-2-3-5(10)7(12)8(13)6(11)4-9/h2,5-13H,1,3-4H2/t5?,6-,7-,8-/m1/s1 |
| InChIKey | ZMFLKZINFYQUJM-UIYHXYAWSA-N |
| XLogP | -2.00 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|