C9H19NO5 — CID 101232405
(2R,3R,4R,5S,6S)-1-aminonon-8-ene-2,3,4,5,6-pentol (PubChem CID 101232405) has the molecular formula C9H19NO5 and a molecular weight of 221.25 g/mol. Its IUPAC name is (2R,3R,4R,5S,6S)-1-aminonon-8-ene-2,3,4,5,6-pentol.
| Compound Name | (2R,3R,4R,5S,6S)-1-aminonon-8-ene-2,3,4,5,6-pentol |
|---|---|
| PubChem CID | 101232405 |
| Molecular Formula | C9H19NO5 |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | (2R,3R,4R,5S,6S)-1-aminonon-8-ene-2,3,4,5,6-pentol |
| SMILES | C=CC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CN |
| InChI | InChI=1S/C9H19NO5/c1-2-3-5(11)7(13)9(15)8(14)6(12)4-10/h2,5-9,11-15H,1,3-4,10H2/t5-,6+,7-,8+,9+/m0/s1 |
| InChIKey | DZHBLHWRENPTOV-KVEIKIFDSA-N |
| XLogP | -2.67 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|