C5H16N2Si — CID 174886622
pent-4-ene-1,2-diamine;silane (PubChem CID 174886622) has the molecular formula C5H16N2Si and a molecular weight of 132.28 g/mol. Its IUPAC name is pent-4-ene-1,2-diamine;silane.
| Compound Name | pent-4-ene-1,2-diamine;silane |
|---|---|
| PubChem CID | 174886622 |
| Molecular Formula | C5H16N2Si |
| Molecular Weight | 132.28 g/mol |
| Exact Mass | 132.11 |
| IUPAC Name | pent-4-ene-1,2-diamine;silane |
| SMILES | C=CCC(N)CN.[SiH4] |
| InChI | InChI=1S/C5H12N2.H4Si/c1-2-3-5(7)4-6;/h2,5H,1,3-4,6-7H2;1H4 |
| InChIKey | ZEGCUVXPNQPJST-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.28 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|