hepta-1,6-dien-4-amine;phosphoric acid

C7H16NO4P — CID 87790614

IUPAChepta-1,6-dien-4-amine;phosphoric acid
SMILESC=CCC(N)CC=C.O=P(O)(O)O
InChIInChI=1S/C7H13N.H3O4P/c1-3-5-7(8)6-4-2;1-5(2,3)4/h3-4,7H,1-2,5-6,8H2;(H3,1,2,3,4)
InChIKeyVDEFDOGEJNRWHU-UHFFFAOYSA-N
MW209.18 g/mol
LogP0.54
Rot. Bonds4

About hepta-1,6-dien-4-amine;phosphoric acid

hepta-1,6-dien-4-amine;phosphoric acid (PubChem CID 87790614) has the molecular formula C7H16NO4P and a molecular weight of 209.18 g/mol. Its IUPAC name is hepta-1,6-dien-4-amine;phosphoric acid.

Molecular Properties

Compound Namehepta-1,6-dien-4-amine;phosphoric acid
PubChem CID87790614
Molecular FormulaC7H16NO4P
Molecular Weight209.18 g/mol
Exact Mass209.08
IUPAC Namehepta-1,6-dien-4-amine;phosphoric acid
SMILESC=CCC(N)CC=C.O=P(O)(O)O
InChIInChI=1S/C7H13N.H3O4P/c1-3-5-7(8)6-4-2;1-5(2,3)4/h3-4,7H,1-2,5-6,8H2;(H3,1,2,3,4)
InChIKeyVDEFDOGEJNRWHU-UHFFFAOYSA-N
XLogP0.54
TPSA103.78 Ų
H-Bond Donors4
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.18
LogP ≤ 50.54
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze hepta-1,6-dien-4-amine;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hepta-1,6-dien-4-amine;phosphoric acid?
The IUPAC name of hepta-1,6-dien-4-amine;phosphoric acid (CID 87790614) is hepta-1,6-dien-4-amine;phosphoric acid.
What is the SMILES notation for hepta-1,6-dien-4-amine;phosphoric acid?
The canonical SMILES for hepta-1,6-dien-4-amine;phosphoric acid is C=CCC(N)CC=C.O=P(O)(O)O.
What is the InChIKey of hepta-1,6-dien-4-amine;phosphoric acid?
The InChIKey is VDEFDOGEJNRWHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N.H3O4P/c1-3-5-7(8)6-4-2;1-5(2,3)4/h3-4,7H,1-2,5-6,8H2;(H3,1,2,3,4).
What are the key properties of hepta-1,6-dien-4-amine;phosphoric acid?
hepta-1,6-dien-4-amine;phosphoric acid has a molecular weight of 209.18 g/mol, XLogP of 0.54, 4 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hepta-1,6-dien-4-amine;phosphoric acid is sourced from PubChem (CID 87790614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).