C7H16NO4P — CID 87790614
hepta-1,6-dien-4-amine;phosphoric acid (PubChem CID 87790614) has the molecular formula C7H16NO4P and a molecular weight of 209.18 g/mol. Its IUPAC name is hepta-1,6-dien-4-amine;phosphoric acid.
| Compound Name | hepta-1,6-dien-4-amine;phosphoric acid |
|---|---|
| PubChem CID | 87790614 |
| Molecular Formula | C7H16NO4P |
| Molecular Weight | 209.18 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | hepta-1,6-dien-4-amine;phosphoric acid |
| SMILES | C=CCC(N)CC=C.O=P(O)(O)O |
| InChI | InChI=1S/C7H13N.H3O4P/c1-3-5-7(8)6-4-2;1-5(2,3)4/h3-4,7H,1-2,5-6,8H2;(H3,1,2,3,4) |
| InChIKey | VDEFDOGEJNRWHU-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.18 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|