About (2S)-2-aminopent-4-enal
(2S)-2-aminopent-4-enal (PubChem CID 160694428) has the molecular formula C5H9NO
and a molecular weight of 99.13 g/mol. Its IUPAC name is (2S)-2-aminopent-4-enal.
Molecular Properties
| Compound Name | (2S)-2-aminopent-4-enal |
| PubChem CID | 160694428 |
| Molecular Formula | C5H9NO |
| Molecular Weight | 99.13 g/mol |
| Exact Mass | 99.07 |
| IUPAC Name | (2S)-2-aminopent-4-enal |
| SMILES | C=CC[C@H](N)C=O |
| InChI | InChI=1S/C5H9NO/c1-2-3-5(6)4-7/h2,4-5H,1,3,6H2/t5-/m0/s1 |
| InChIKey | DFYOJOKZBAZMGP-YFKPBYRVSA-N |
| XLogP | 0.09 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.13 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-aminopent-4-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminopent-4-enal?
The IUPAC name of (2S)-2-aminopent-4-enal (CID 160694428) is (2S)-2-aminopent-4-enal.
What is the SMILES notation for (2S)-2-aminopent-4-enal?
The canonical SMILES for (2S)-2-aminopent-4-enal is C=CC[C@H](N)C=O.
What is the InChIKey of (2S)-2-aminopent-4-enal?
The InChIKey is DFYOJOKZBAZMGP-YFKPBYRVSA-N. The full InChI is InChI=1S/C5H9NO/c1-2-3-5(6)4-7/h2,4-5H,1,3,6H2/t5-/m0/s1.
What are the key properties of (2S)-2-aminopent-4-enal?
(2S)-2-aminopent-4-enal has a molecular weight of 99.13 g/mol, XLogP of 0.09, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminopent-4-enal is sourced from PubChem (CID 160694428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).