About (3R)-3-amino-4-oxobutanamide;ethene;methane
(3R)-3-amino-4-oxobutanamide;ethene;methane (PubChem CID 158060763) has the molecular formula C14H44N2O2
and a molecular weight of 272.52 g/mol. Its IUPAC name is (3R)-3-amino-4-oxobutanamide;ethene;methane.
Molecular Properties
| Compound Name | (3R)-3-amino-4-oxobutanamide;ethene;methane |
| PubChem CID | 158060763 |
| Molecular Formula | C14H44N2O2 |
| Molecular Weight | 272.52 g/mol |
| Exact Mass | 272.34 |
| IUPAC Name | (3R)-3-amino-4-oxobutanamide;ethene;methane |
| SMILES | C.C.C.C.C.C.C.C.C=C.NC(=O)C[C@@H](N)C=O |
| InChI | InChI=1S/C4H8N2O2.C2H4.8CH4/c5-3(2-7)1-4(6)8;1-2;;;;;;;;/h2-3H,1,5H2,(H2,6,8);1-2H2;8*1H4/t3-;;;;;;;;;/m1........./s1 |
| InChIKey | FKPMTBKEFGJRQT-DPEVDOEVSA-N |
| XLogP | 4.28 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-amino-4-oxobutanamide;ethene;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-amino-4-oxobutanamide;ethene;methane?
The IUPAC name of (3R)-3-amino-4-oxobutanamide;ethene;methane (CID 158060763) is (3R)-3-amino-4-oxobutanamide;ethene;methane.
What is the SMILES notation for (3R)-3-amino-4-oxobutanamide;ethene;methane?
The canonical SMILES for (3R)-3-amino-4-oxobutanamide;ethene;methane is C.C.C.C.C.C.C.C.C=C.NC(=O)C[C@@H](N)C=O.
What is the InChIKey of (3R)-3-amino-4-oxobutanamide;ethene;methane?
The InChIKey is FKPMTBKEFGJRQT-DPEVDOEVSA-N. The full InChI is InChI=1S/C4H8N2O2.C2H4.8CH4/c5-3(2-7)1-4(6)8;1-2;;;;;;;;/h2-3H,1,5H2,(H2,6,8);1-2H2;8*1H4/t3-;;;;;;;;;/m1........./s1.
What are the key properties of (3R)-3-amino-4-oxobutanamide;ethene;methane?
(3R)-3-amino-4-oxobutanamide;ethene;methane has a molecular weight of 272.52 g/mol, XLogP of 4.28, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-amino-4-oxobutanamide;ethene;methane is sourced from PubChem (CID 158060763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).