C7H11N3O3 — CID 146479347
2-amino-N-prop-2-enoylbutanediamide (PubChem CID 146479347) has the molecular formula C7H11N3O3 and a molecular weight of 185.18 g/mol. Its IUPAC name is 2-amino-N-prop-2-enoylbutanediamide.
| Compound Name | 2-amino-N-prop-2-enoylbutanediamide |
|---|---|
| PubChem CID | 146479347 |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 2-amino-N-prop-2-enoylbutanediamide |
| SMILES | C=CC(=O)NC(=O)C(N)CC(N)=O |
| InChI | InChI=1S/C7H11N3O3/c1-2-6(12)10-7(13)4(8)3-5(9)11/h2,4H,1,3,8H2,(H2,9,11)(H,10,12,13) |
| InChIKey | WIEFOJWXOGVOKJ-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|