3-[(2,4-diamino-4-oxobutanoyl)amino]-2-hydroxypropanoic acid

C7H13N3O5 — CID 66168013

IUPAC3-[(2,4-diamino-4-oxobutanoyl)amino]-2-hydroxypropanoic acid
SMILESNC(=O)CC(N)C(=O)NCC(O)C(=O)O
InChIInChI=1S/C7H13N3O5/c8-3(1-5(9)12)6(13)10-2-4(11)7(14)15/h3-4,11H,1-2,8H2,(H2,9,12)(H,10,13)(H,14,15)
InChIKeyXMVMAGQPXCDDHG-UHFFFAOYSA-N
MW219.20 g/mol
LogP-3.25
Rot. Bonds6

About 3-[(2,4-diamino-4-oxobutanoyl)amino]-2-hydroxypropanoic acid

3-[(2,4-diamino-4-oxobutanoyl)amino]-2-hydroxypropanoic acid (PubChem CID 66168013) has the molecular formula C7H13N3O5 and a molecular weight of 219.20 g/mol. Its IUPAC name is 3-[(2,4-diamino-4-oxobutanoyl)amino]-2-hydroxypropanoic acid.

Molecular Properties

Compound Name3-[(2,4-diamino-4-oxobutanoyl)amino]-2-hydroxypropanoic acid
PubChem CID66168013
Molecular FormulaC7H13N3O5
Molecular Weight219.20 g/mol
Exact Mass219.09
IUPAC Name3-[(2,4-diamino-4-oxobutanoyl)amino]-2-hydroxypropanoic acid
SMILESNC(=O)CC(N)C(=O)NCC(O)C(=O)O
InChIInChI=1S/C7H13N3O5/c8-3(1-5(9)12)6(13)10-2-4(11)7(14)15/h3-4,11H,1-2,8H2,(H2,9,12)(H,10,13)(H,14,15)
InChIKeyXMVMAGQPXCDDHG-UHFFFAOYSA-N
XLogP-3.25
TPSA155.74 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.20
LogP ≤ 5-3.25
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Analyze 3-[(2,4-diamino-4-oxobutanoyl)amino]-2-hydroxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(2,4-diamino-4-oxobutanoyl)amino]-2-hydroxypropanoic acid?
The IUPAC name of 3-[(2,4-diamino-4-oxobutanoyl)amino]-2-hydroxypropanoic acid (CID 66168013) is 3-[(2,4-diamino-4-oxobutanoyl)amino]-2-hydroxypropanoic acid.
What is the SMILES notation for 3-[(2,4-diamino-4-oxobutanoyl)amino]-2-hydroxypropanoic acid?
The canonical SMILES for 3-[(2,4-diamino-4-oxobutanoyl)amino]-2-hydroxypropanoic acid is NC(=O)CC(N)C(=O)NCC(O)C(=O)O.
What is the InChIKey of 3-[(2,4-diamino-4-oxobutanoyl)amino]-2-hydroxypropanoic acid?
The InChIKey is XMVMAGQPXCDDHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O5/c8-3(1-5(9)12)6(13)10-2-4(11)7(14)15/h3-4,11H,1-2,8H2,(H2,9,12)(H,10,13)(H,14,15).
What are the key properties of 3-[(2,4-diamino-4-oxobutanoyl)amino]-2-hydroxypropanoic acid?
3-[(2,4-diamino-4-oxobutanoyl)amino]-2-hydroxypropanoic acid has a molecular weight of 219.20 g/mol, XLogP of -3.25, 6 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,4-diamino-4-oxobutanoyl)amino]-2-hydroxypropanoic acid is sourced from PubChem (CID 66168013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).