C9H17N3O4 — CID 65224539
2-[[(2,4-diamino-4-oxobutanoyl)amino]methyl]butanoic acid (PubChem CID 65224539) has the molecular formula C9H17N3O4 and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-[[(2,4-diamino-4-oxobutanoyl)amino]methyl]butanoic acid.
| Compound Name | 2-[[(2,4-diamino-4-oxobutanoyl)amino]methyl]butanoic acid |
|---|---|
| PubChem CID | 65224539 |
| Molecular Formula | C9H17N3O4 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 2-[[(2,4-diamino-4-oxobutanoyl)amino]methyl]butanoic acid |
| SMILES | CCC(CNC(=O)C(N)CC(N)=O)C(=O)O |
| InChI | InChI=1S/C9H17N3O4/c1-2-5(9(15)16)4-12-8(14)6(10)3-7(11)13/h5-6H,2-4,10H2,1H3,(H2,11,13)(H,12,14)(H,15,16) |
| InChIKey | RZMZCMPWJYPJRB-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |