C6H13N3O4 — CID 154111575
2-amino-N-(2,2-dihydroxyethyl)butanediamide (PubChem CID 154111575) has the molecular formula C6H13N3O4 and a molecular weight of 191.19 g/mol. Its IUPAC name is 2-amino-N-(2,2-dihydroxyethyl)butanediamide.
| Compound Name | 2-amino-N-(2,2-dihydroxyethyl)butanediamide |
|---|---|
| PubChem CID | 154111575 |
| Molecular Formula | C6H13N3O4 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 2-amino-N-(2,2-dihydroxyethyl)butanediamide |
| SMILES | NC(=O)CC(N)C(=O)NCC(O)O |
| InChI | InChI=1S/C6H13N3O4/c7-3(1-4(8)10)6(13)9-2-5(11)12/h3,5,11-12H,1-2,7H2,(H2,8,10)(H,9,13) |
| InChIKey | XOZZVTZRMJPFBR-UHFFFAOYSA-N |
| XLogP | -3.38 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|