C8H16N4O4 — CID 87306158
2-[(2,4-diamino-4-oxobutanoyl)amino]ethyl-methylcarbamic acid (PubChem CID 87306158) has the molecular formula C8H16N4O4 and a molecular weight of 232.24 g/mol. Its IUPAC name is 2-[(2,4-diamino-4-oxobutanoyl)amino]ethyl-methylcarbamic acid.
| Compound Name | 2-[(2,4-diamino-4-oxobutanoyl)amino]ethyl-methylcarbamic acid |
|---|---|
| PubChem CID | 87306158 |
| Molecular Formula | C8H16N4O4 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 2-[(2,4-diamino-4-oxobutanoyl)amino]ethyl-methylcarbamic acid |
| SMILES | CN(CCNC(=O)C(N)CC(N)=O)C(=O)O |
| InChI | InChI=1S/C8H16N4O4/c1-12(8(15)16)3-2-11-7(14)5(9)4-6(10)13/h5H,2-4,9H2,1H3,(H2,10,13)(H,11,14)(H,15,16) |
| InChIKey | SDVLLVMBVNSYAY-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |