C9H22N2O2 — CID 161126143
methyl-[2-(methylamino)ethyl]carbamic acid;2-methylpropane (PubChem CID 161126143) has the molecular formula C9H22N2O2 and a molecular weight of 190.29 g/mol. Its IUPAC name is methyl-[2-(methylamino)ethyl]carbamic acid;2-methylpropane.
| Compound Name | methyl-[2-(methylamino)ethyl]carbamic acid;2-methylpropane |
|---|---|
| PubChem CID | 161126143 |
| Molecular Formula | C9H22N2O2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | methyl-[2-(methylamino)ethyl]carbamic acid;2-methylpropane |
| SMILES | CC(C)C.CNCCN(C)C(=O)O |
| InChI | InChI=1S/C5H12N2O2.C4H10/c1-6-3-4-7(2)5(8)9;1-4(2)3/h6H,3-4H2,1-2H3,(H,8,9);4H,1-3H3 |
| InChIKey | ULOULRPFEFYMSA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |