C6H13N3O4S — CID 103306832
2-amino-N-ethylsulfonylbutanediamide (PubChem CID 103306832) has the molecular formula C6H13N3O4S and a molecular weight of 223.25 g/mol. Its IUPAC name is 2-amino-N-ethylsulfonylbutanediamide.
| Compound Name | 2-amino-N-ethylsulfonylbutanediamide |
|---|---|
| PubChem CID | 103306832 |
| Molecular Formula | C6H13N3O4S |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 2-amino-N-ethylsulfonylbutanediamide |
| SMILES | CCS(=O)(=O)NC(=O)C(N)CC(N)=O |
| InChI | InChI=1S/C6H13N3O4S/c1-2-14(12,13)9-6(11)4(7)3-5(8)10/h4H,2-3,7H2,1H3,(H2,8,10)(H,9,11) |
| InChIKey | CFHDHDMVHRGRJJ-UHFFFAOYSA-N |
| XLogP | -2.35 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |