C11H16N4O4S — CID 60851728
2-amino-N-[4-(methylsulfamoyl)phenyl]butanediamide (PubChem CID 60851728) has the molecular formula C11H16N4O4S and a molecular weight of 300.34 g/mol. Its IUPAC name is 2-amino-N-[4-(methylsulfamoyl)phenyl]butanediamide.
| Compound Name | 2-amino-N-[4-(methylsulfamoyl)phenyl]butanediamide |
|---|---|
| PubChem CID | 60851728 |
| Molecular Formula | C11H16N4O4S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-amino-N-[4-(methylsulfamoyl)phenyl]butanediamide |
| SMILES | CNS(=O)(=O)c1ccc(NC(=O)C(N)CC(N)=O)cc1 |
| InChI | InChI=1S/C11H16N4O4S/c1-14-20(18,19)8-4-2-7(3-5-8)15-11(17)9(12)6-10(13)16/h2-5,9,14H,6,12H2,1H3,(H2,13,16)(H,15,17) |
| InChIKey | GNKSJBNTEYGEDH-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |