C10H15Cl2N3O2 — CID 70455433
2-amino-N-phenylbutanediamide;dihydrochloride (PubChem CID 70455433) has the molecular formula C10H15Cl2N3O2 and a molecular weight of 280.15 g/mol. Its IUPAC name is 2-amino-N-phenylbutanediamide;dihydrochloride.
| Compound Name | 2-amino-N-phenylbutanediamide;dihydrochloride |
|---|---|
| PubChem CID | 70455433 |
| Molecular Formula | C10H15Cl2N3O2 |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 2-amino-N-phenylbutanediamide;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)CC(N)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C10H13N3O2.2ClH/c11-8(6-9(12)14)10(15)13-7-4-2-1-3-5-7;;/h1-5,8H,6,11H2,(H2,12,14)(H,13,15);2*1H |
| InChIKey | PAPVUCHGMUHUKK-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |