C15H23ClN4O3 — CID 119955979
2-amino-N-[4-(diethylcarbamoyl)phenyl]butanediamide;hydrochloride (PubChem CID 119955979) has the molecular formula C15H23ClN4O3 and a molecular weight of 342.83 g/mol. Its IUPAC name is 2-amino-N-[4-(diethylcarbamoyl)phenyl]butanediamide;hydrochloride.
| Compound Name | 2-amino-N-[4-(diethylcarbamoyl)phenyl]butanediamide;hydrochloride |
|---|---|
| PubChem CID | 119955979 |
| Molecular Formula | C15H23ClN4O3 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 2-amino-N-[4-(diethylcarbamoyl)phenyl]butanediamide;hydrochloride |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)C(N)CC(N)=O)cc1.Cl |
| InChI | InChI=1S/C15H22N4O3.ClH/c1-3-19(4-2)15(22)10-5-7-11(8-6-10)18-14(21)12(16)9-13(17)20;/h5-8,12H,3-4,9,16H2,1-2H3,(H2,17,20)(H,18,21);1H |
| InChIKey | JSGFNGBUZPQNQC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |