C13H15N3O4 — CID 115342327
(E)-3-[4-[(2,4-diamino-4-oxobutanoyl)amino]phenyl]prop-2-enoic acid (PubChem CID 115342327) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is (E)-3-[4-[(2,4-diamino-4-oxobutanoyl)amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(2,4-diamino-4-oxobutanoyl)amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 115342327 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | (E)-3-[4-[(2,4-diamino-4-oxobutanoyl)amino]phenyl]prop-2-enoic acid |
| SMILES | NC(=O)CC(N)C(=O)Nc1ccc(/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C13H15N3O4/c14-10(7-11(15)17)13(20)16-9-4-1-8(2-5-9)3-6-12(18)19/h1-6,10H,7,14H2,(H2,15,17)(H,16,20)(H,18,19)/b6-3+ |
| InChIKey | ADXJVBHSTPKDAX-ZZXKWVIFSA-N |
| XLogP | -0.07 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|