C11H13N3O4 — CID 61157183
2-[(2,4-diamino-4-oxobutanoyl)amino]benzoic acid (PubChem CID 61157183) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is 2-[(2,4-diamino-4-oxobutanoyl)amino]benzoic acid.
| Compound Name | 2-[(2,4-diamino-4-oxobutanoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 61157183 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 2-[(2,4-diamino-4-oxobutanoyl)amino]benzoic acid |
| SMILES | NC(=O)CC(N)C(=O)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C11H13N3O4/c12-7(5-9(13)15)10(16)14-8-4-2-1-3-6(8)11(17)18/h1-4,7H,5,12H2,(H2,13,15)(H,14,16)(H,17,18) |
| InChIKey | YBTWAOMYSAKGON-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |