C12H15N3O5 — CID 115411602
2-[(2,4-diamino-4-oxobutanoyl)amino]-4-methoxybenzoic acid (PubChem CID 115411602) has the molecular formula C12H15N3O5 and a molecular weight of 281.27 g/mol. Its IUPAC name is 2-[(2,4-diamino-4-oxobutanoyl)amino]-4-methoxybenzoic acid.
| Compound Name | 2-[(2,4-diamino-4-oxobutanoyl)amino]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 115411602 |
| Molecular Formula | C12H15N3O5 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2-[(2,4-diamino-4-oxobutanoyl)amino]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)c(NC(=O)C(N)CC(N)=O)c1 |
| InChI | InChI=1S/C12H15N3O5/c1-20-6-2-3-7(12(18)19)9(4-6)15-11(17)8(13)5-10(14)16/h2-4,8H,5,13H2,1H3,(H2,14,16)(H,15,17)(H,18,19) |
| InChIKey | HATNTPMOPGXTJZ-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 144.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |