C11H12BrN3O4 — CID 107813544
4-bromo-3-[(2,4-diamino-4-oxobutanoyl)amino]benzoic acid (PubChem CID 107813544) has the molecular formula C11H12BrN3O4 and a molecular weight of 330.14 g/mol. Its IUPAC name is 4-bromo-3-[(2,4-diamino-4-oxobutanoyl)amino]benzoic acid.
| Compound Name | 4-bromo-3-[(2,4-diamino-4-oxobutanoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 107813544 |
| Molecular Formula | C11H12BrN3O4 |
| Molecular Weight | 330.14 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 4-bromo-3-[(2,4-diamino-4-oxobutanoyl)amino]benzoic acid |
| SMILES | NC(=O)CC(N)C(=O)Nc1cc(C(=O)O)ccc1Br |
| InChI | InChI=1S/C11H12BrN3O4/c12-6-2-1-5(11(18)19)3-8(6)15-10(17)7(13)4-9(14)16/h1-3,7H,4,13H2,(H2,14,16)(H,15,17)(H,18,19) |
| InChIKey | SEYXUPKRJLSTKM-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.14 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |