C11H13ClN4O3 — CID 60847978
2-amino-N-(5-carbamoyl-2-chlorophenyl)butanediamide (PubChem CID 60847978) has the molecular formula C11H13ClN4O3 and a molecular weight of 284.70 g/mol. Its IUPAC name is 2-amino-N-(5-carbamoyl-2-chlorophenyl)butanediamide.
| Compound Name | 2-amino-N-(5-carbamoyl-2-chlorophenyl)butanediamide |
|---|---|
| PubChem CID | 60847978 |
| Molecular Formula | C11H13ClN4O3 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 2-amino-N-(5-carbamoyl-2-chlorophenyl)butanediamide |
| SMILES | NC(=O)CC(N)C(=O)Nc1cc(C(N)=O)ccc1Cl |
| InChI | InChI=1S/C11H13ClN4O3/c12-6-2-1-5(10(15)18)3-8(6)16-11(19)7(13)4-9(14)17/h1-3,7H,4,13H2,(H2,14,17)(H2,15,18)(H,16,19) |
| InChIKey | NIMATBHPIHTPKV-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 141.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |