C13H18FN3O2 — CID 104902798
3-[[(2R)-2-amino-4-methylpentanoyl]amino]-4-fluorobenzamide (PubChem CID 104902798) has the molecular formula C13H18FN3O2 and a molecular weight of 267.30 g/mol. Its IUPAC name is 3-[[(2R)-2-amino-4-methylpentanoyl]amino]-4-fluorobenzamide.
| Compound Name | 3-[[(2R)-2-amino-4-methylpentanoyl]amino]-4-fluorobenzamide |
|---|---|
| PubChem CID | 104902798 |
| Molecular Formula | C13H18FN3O2 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 3-[[(2R)-2-amino-4-methylpentanoyl]amino]-4-fluorobenzamide |
| SMILES | CC(C)C[C@@H](N)C(=O)Nc1cc(C(N)=O)ccc1F |
| InChI | InChI=1S/C13H18FN3O2/c1-7(2)5-10(15)13(19)17-11-6-8(12(16)18)3-4-9(11)14/h3-4,6-7,10H,5,15H2,1-2H3,(H2,16,18)(H,17,19)/t10-/m1/s1 |
| InChIKey | DHWZBQLXUJQDFF-SNVBAGLBSA-N |
| XLogP | 1.24 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |