C13H18FN3O3 — CID 81083526
3-[(2-amino-5-methoxypentanoyl)amino]-4-fluorobenzamide (PubChem CID 81083526) has the molecular formula C13H18FN3O3 and a molecular weight of 283.30 g/mol. Its IUPAC name is 3-[(2-amino-5-methoxypentanoyl)amino]-4-fluorobenzamide.
| Compound Name | 3-[(2-amino-5-methoxypentanoyl)amino]-4-fluorobenzamide |
|---|---|
| PubChem CID | 81083526 |
| Molecular Formula | C13H18FN3O3 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 3-[(2-amino-5-methoxypentanoyl)amino]-4-fluorobenzamide |
| SMILES | COCCCC(N)C(=O)Nc1cc(C(N)=O)ccc1F |
| InChI | InChI=1S/C13H18FN3O3/c1-20-6-2-3-10(15)13(19)17-11-7-8(12(16)18)4-5-9(11)14/h4-5,7,10H,2-3,6,15H2,1H3,(H2,16,18)(H,17,19) |
| InChIKey | OUALYGVOKNBDFN-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|