C14H19ClN2O4 — CID 81084917
methyl 2-[(2-amino-5-methoxypentanoyl)amino]-4-chlorobenzoate (PubChem CID 81084917) has the molecular formula C14H19ClN2O4 and a molecular weight of 314.77 g/mol. Its IUPAC name is methyl 2-[(2-amino-5-methoxypentanoyl)amino]-4-chlorobenzoate.
| Compound Name | methyl 2-[(2-amino-5-methoxypentanoyl)amino]-4-chlorobenzoate |
|---|---|
| PubChem CID | 81084917 |
| Molecular Formula | C14H19ClN2O4 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | methyl 2-[(2-amino-5-methoxypentanoyl)amino]-4-chlorobenzoate |
| SMILES | COCCCC(N)C(=O)Nc1cc(Cl)ccc1C(=O)OC |
| InChI | InChI=1S/C14H19ClN2O4/c1-20-7-3-4-11(16)13(18)17-12-8-9(15)5-6-10(12)14(19)21-2/h5-6,8,11H,3-4,7,16H2,1-2H3,(H,17,18) |
| InChIKey | TVGNJJOLDFPLDY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|