C13H17FN6O — CID 104902971
(2R)-2-amino-N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-4-methylpentanamide (PubChem CID 104902971) has the molecular formula C13H17FN6O and a molecular weight of 292.32 g/mol. Its IUPAC name is (2R)-2-amino-N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-4-methylpentanamide.
| Compound Name | (2R)-2-amino-N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 104902971 |
| Molecular Formula | C13H17FN6O |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | (2R)-2-amino-N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](N)C(=O)Nc1cc(-n2cnnn2)ccc1F |
| InChI | InChI=1S/C13H17FN6O/c1-8(2)5-11(15)13(21)17-12-6-9(3-4-10(12)14)20-7-16-18-19-20/h3-4,6-8,11H,5,15H2,1-2H3,(H,17,21)/t11-/m1/s1 |
| InChIKey | DJLNXVDYXVBKNY-LLVKDONJSA-N |
| XLogP | 1.11 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |