C10H11FN6O — CID 54862457
N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-2-(methylamino)acetamide (PubChem CID 54862457) has the molecular formula C10H11FN6O and a molecular weight of 250.24 g/mol. Its IUPAC name is N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-2-(methylamino)acetamide.
| Compound Name | N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 54862457 |
| Molecular Formula | C10H11FN6O |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-2-(methylamino)acetamide |
| SMILES | CNCC(=O)Nc1cc(-n2cnnn2)ccc1F |
| InChI | InChI=1S/C10H11FN6O/c1-12-5-10(18)14-9-4-7(2-3-8(9)11)17-6-13-15-16-17/h2-4,6,12H,5H2,1H3,(H,14,18) |
| InChIKey | DRZZALGBXVVPLS-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |