C17H16FN5O3 — CID 55811964
2-(3,4-dimethoxyphenyl)-N-[2-fluoro-5-(tetrazol-1-yl)phenyl]acetamide (PubChem CID 55811964) has the molecular formula C17H16FN5O3 and a molecular weight of 357.35 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[2-fluoro-5-(tetrazol-1-yl)phenyl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[2-fluoro-5-(tetrazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 55811964 |
| Molecular Formula | C17H16FN5O3 |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[2-fluoro-5-(tetrazol-1-yl)phenyl]acetamide |
| SMILES | COc1ccc(CC(=O)Nc2cc(-n3cnnn3)ccc2F)cc1OC |
| InChI | InChI=1S/C17H16FN5O3/c1-25-15-6-3-11(7-16(15)26-2)8-17(24)20-14-9-12(4-5-13(14)18)23-10-19-21-22-23/h3-7,9-10H,8H2,1-2H3,(H,20,24) |
| InChIKey | HELIJOBVDIPHDW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |