C12H14FN5O2 — CID 79199600
N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-5-hydroxypentanamide (PubChem CID 79199600) has the molecular formula C12H14FN5O2 and a molecular weight of 279.27 g/mol. Its IUPAC name is N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-5-hydroxypentanamide.
| Compound Name | N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-5-hydroxypentanamide |
|---|---|
| PubChem CID | 79199600 |
| Molecular Formula | C12H14FN5O2 |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-5-hydroxypentanamide |
| SMILES | O=C(CCCCO)Nc1cc(-n2cnnn2)ccc1F |
| InChI | InChI=1S/C12H14FN5O2/c13-10-5-4-9(18-8-14-16-17-18)7-11(10)15-12(20)3-1-2-6-19/h4-5,7-8,19H,1-3,6H2,(H,15,20) |
| InChIKey | IYROMFDZZQLMOY-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|