C12H13FN6O — CID 79285392
N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-2-(prop-2-enylamino)acetamide (PubChem CID 79285392) has the molecular formula C12H13FN6O and a molecular weight of 276.28 g/mol. Its IUPAC name is N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-2-(prop-2-enylamino)acetamide.
| Compound Name | N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-2-(prop-2-enylamino)acetamide |
|---|---|
| PubChem CID | 79285392 |
| Molecular Formula | C12H13FN6O |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-2-(prop-2-enylamino)acetamide |
| SMILES | C=CCNCC(=O)Nc1cc(-n2cnnn2)ccc1F |
| InChI | InChI=1S/C12H13FN6O/c1-2-5-14-7-12(20)16-11-6-9(3-4-10(11)13)19-8-15-17-18-19/h2-4,6,8,14H,1,5,7H2,(H,16,20) |
| InChIKey | ONBOLGAVGBMASY-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|