C12H13ClFN5O — CID 63681109
3-chloro-N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-2,2-dimethylpropanamide (PubChem CID 63681109) has the molecular formula C12H13ClFN5O and a molecular weight of 297.72 g/mol. Its IUPAC name is 3-chloro-N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 63681109 |
| Molecular Formula | C12H13ClFN5O |
| Molecular Weight | 297.72 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 3-chloro-N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CCl)C(=O)Nc1cc(-n2cnnn2)ccc1F |
| InChI | InChI=1S/C12H13ClFN5O/c1-12(2,6-13)11(20)16-10-5-8(3-4-9(10)14)19-7-15-17-18-19/h3-5,7H,6H2,1-2H3,(H,16,20) |
| InChIKey | NPJKZVZCEMWQTB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.72 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|