C16H12F3N5O3 — CID 51123666
3-(difluoromethoxy)-N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-4-methoxybenzamide (PubChem CID 51123666) has the molecular formula C16H12F3N5O3 and a molecular weight of 379.30 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-4-methoxybenzamide.
| Compound Name | 3-(difluoromethoxy)-N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 51123666 |
| Molecular Formula | C16H12F3N5O3 |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 3-(difluoromethoxy)-N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(-n3cnnn3)ccc2F)cc1OC(F)F |
| InChI | InChI=1S/C16H12F3N5O3/c1-26-13-5-2-9(6-14(13)27-16(18)19)15(25)21-12-7-10(3-4-11(12)17)24-8-20-22-23-24/h2-8,16H,1H3,(H,21,25) |
| InChIKey | QHYRMSNZFZEVTD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |