C14H11FN6O2 — CID 51090541
N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-6-methoxypyridine-3-carboxamide (PubChem CID 51090541) has the molecular formula C14H11FN6O2 and a molecular weight of 314.28 g/mol. Its IUPAC name is N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-6-methoxypyridine-3-carboxamide.
| Compound Name | N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-6-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 51090541 |
| Molecular Formula | C14H11FN6O2 |
| Molecular Weight | 314.28 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-6-methoxypyridine-3-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2cc(-n3cnnn3)ccc2F)cn1 |
| InChI | InChI=1S/C14H11FN6O2/c1-23-13-5-2-9(7-16-13)14(22)18-12-6-10(3-4-11(12)15)21-8-17-19-20-21/h2-8H,1H3,(H,18,22) |
| InChIKey | XRWRFCGHFBZAOP-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |