C12H14N6O3 — CID 64895694
3-amino-4-[2-methyl-5-(tetrazol-1-yl)anilino]-4-oxobutanoic acid (PubChem CID 64895694) has the molecular formula C12H14N6O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is 3-amino-4-[2-methyl-5-(tetrazol-1-yl)anilino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[2-methyl-5-(tetrazol-1-yl)anilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 64895694 |
| Molecular Formula | C12H14N6O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 3-amino-4-[2-methyl-5-(tetrazol-1-yl)anilino]-4-oxobutanoic acid |
| SMILES | Cc1ccc(-n2cnnn2)cc1NC(=O)C(N)CC(=O)O |
| InChI | InChI=1S/C12H14N6O3/c1-7-2-3-8(18-6-14-16-17-18)4-10(7)15-12(21)9(13)5-11(19)20/h2-4,6,9H,5,13H2,1H3,(H,15,21)(H,19,20) |
| InChIKey | QUWPUYHDMHTSJL-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |