C18H24N8O — CID 124847631
1-[(2S)-3-methyl-2-(2-methylpyrazol-3-yl)butyl]-3-[2-methyl-5-(tetrazol-1-yl)phenyl]urea (PubChem CID 124847631) has the molecular formula C18H24N8O and a molecular weight of 368.45 g/mol. Its IUPAC name is 1-[(2S)-3-methyl-2-(2-methylpyrazol-3-yl)butyl]-3-[2-methyl-5-(tetrazol-1-yl)phenyl]urea.
| Compound Name | 1-[(2S)-3-methyl-2-(2-methylpyrazol-3-yl)butyl]-3-[2-methyl-5-(tetrazol-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 124847631 |
| Molecular Formula | C18H24N8O |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 1-[(2S)-3-methyl-2-(2-methylpyrazol-3-yl)butyl]-3-[2-methyl-5-(tetrazol-1-yl)phenyl]urea |
| SMILES | Cc1ccc(-n2cnnn2)cc1NC(=O)NC[C@@H](c1ccnn1C)C(C)C |
| InChI | InChI=1S/C18H24N8O/c1-12(2)15(17-7-8-21-25(17)4)10-19-18(27)22-16-9-14(6-5-13(16)3)26-11-20-23-24-26/h5-9,11-12,15H,10H2,1-4H3,(H2,19,22,27)/t15-/m1/s1 |
| InChIKey | LENCGRSEXPUARK-OAHLLOKOSA-N |
| XLogP | 2.27 |
| TPSA | 102.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |