C20H24N6O2 — CID 119047495
1-(2-benzyl-3-hydroxy-2-methylpropyl)-3-[2-methyl-5-(tetrazol-1-yl)phenyl]urea (PubChem CID 119047495) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 1-(2-benzyl-3-hydroxy-2-methylpropyl)-3-[2-methyl-5-(tetrazol-1-yl)phenyl]urea.
| Compound Name | 1-(2-benzyl-3-hydroxy-2-methylpropyl)-3-[2-methyl-5-(tetrazol-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 119047495 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 1-(2-benzyl-3-hydroxy-2-methylpropyl)-3-[2-methyl-5-(tetrazol-1-yl)phenyl]urea |
| SMILES | Cc1ccc(-n2cnnn2)cc1NC(=O)NCC(C)(CO)Cc1ccccc1 |
| InChI | InChI=1S/C20H24N6O2/c1-15-8-9-17(26-14-22-24-25-26)10-18(15)23-19(28)21-12-20(2,13-27)11-16-6-4-3-5-7-16/h3-10,14,27H,11-13H2,1-2H3,(H2,21,23,28) |
| InChIKey | RAEVDCGAKWSSMB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |