C14H20N6O — CID 78923820
2-(tert-butylamino)-N-[2-methyl-5-(tetrazol-1-yl)phenyl]acetamide (PubChem CID 78923820) has the molecular formula C14H20N6O and a molecular weight of 288.36 g/mol. Its IUPAC name is 2-(tert-butylamino)-N-[2-methyl-5-(tetrazol-1-yl)phenyl]acetamide.
| Compound Name | 2-(tert-butylamino)-N-[2-methyl-5-(tetrazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 78923820 |
| Molecular Formula | C14H20N6O |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 2-(tert-butylamino)-N-[2-methyl-5-(tetrazol-1-yl)phenyl]acetamide |
| SMILES | Cc1ccc(-n2cnnn2)cc1NC(=O)CNC(C)(C)C |
| InChI | InChI=1S/C14H20N6O/c1-10-5-6-11(20-9-16-18-19-20)7-12(10)17-13(21)8-15-14(2,3)4/h5-7,9,15H,8H2,1-4H3,(H,17,21) |
| InChIKey | PUYKDEBWMBLFQR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |