C17H15Cl2N5O — CID 55780794
3-(2,4-dichlorophenyl)-N-[2-methyl-5-(tetrazol-1-yl)phenyl]propanamide (PubChem CID 55780794) has the molecular formula C17H15Cl2N5O and a molecular weight of 376.25 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N-[2-methyl-5-(tetrazol-1-yl)phenyl]propanamide.
| Compound Name | 3-(2,4-dichlorophenyl)-N-[2-methyl-5-(tetrazol-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 55780794 |
| Molecular Formula | C17H15Cl2N5O |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N-[2-methyl-5-(tetrazol-1-yl)phenyl]propanamide |
| SMILES | Cc1ccc(-n2cnnn2)cc1NC(=O)CCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H15Cl2N5O/c1-11-2-6-14(24-10-20-22-23-24)9-16(11)21-17(25)7-4-12-3-5-13(18)8-15(12)19/h2-3,5-6,8-10H,4,7H2,1H3,(H,21,25) |
| InChIKey | ARPUWPMAPTVPHM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |