C12H15ClN6O — CID 61178561
(2S)-2-amino-N-[2-chloro-5-(tetrazol-1-yl)phenyl]-3-methylbutanamide (PubChem CID 61178561) has the molecular formula C12H15ClN6O and a molecular weight of 294.75 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-chloro-5-(tetrazol-1-yl)phenyl]-3-methylbutanamide.
| Compound Name | (2S)-2-amino-N-[2-chloro-5-(tetrazol-1-yl)phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 61178561 |
| Molecular Formula | C12H15ClN6O |
| Molecular Weight | 294.75 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | (2S)-2-amino-N-[2-chloro-5-(tetrazol-1-yl)phenyl]-3-methylbutanamide |
| SMILES | CC(C)[C@H](N)C(=O)Nc1cc(-n2cnnn2)ccc1Cl |
| InChI | InChI=1S/C12H15ClN6O/c1-7(2)11(14)12(20)16-10-5-8(3-4-9(10)13)19-6-15-17-18-19/h3-7,11H,14H2,1-2H3,(H,16,20)/t11-/m0/s1 |
| InChIKey | QNJFREICRGQUTD-NSHDSACASA-N |
| XLogP | 1.24 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.75 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |