C17H13Cl2N5O3 — CID 2669049
[(2S)-1-(2,5-dichloroanilino)-1-oxopropan-2-yl] 4-(tetrazol-1-yl)benzoate (PubChem CID 2669049) has the molecular formula C17H13Cl2N5O3 and a molecular weight of 406.23 g/mol. Its IUPAC name is [(2S)-1-(2,5-dichloroanilino)-1-oxopropan-2-yl] 4-(tetrazol-1-yl)benzoate.
| Compound Name | [(2S)-1-(2,5-dichloroanilino)-1-oxopropan-2-yl] 4-(tetrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 2669049 |
| Molecular Formula | C17H13Cl2N5O3 |
| Molecular Weight | 406.23 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | [(2S)-1-(2,5-dichloroanilino)-1-oxopropan-2-yl] 4-(tetrazol-1-yl)benzoate |
| SMILES | C[C@H](OC(=O)c1ccc(-n2cnnn2)cc1)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H13Cl2N5O3/c1-10(16(25)21-15-8-12(18)4-7-14(15)19)27-17(26)11-2-5-13(6-3-11)24-9-20-22-23-24/h2-10H,1H3,(H,21,25)/t10-/m0/s1 |
| InChIKey | OZTDXYHGJSDZFQ-JTQLQIEISA-N |
| XLogP | 3.15 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.23 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |