C18H18Cl2N2O3 — CID 8534023
[(2R)-1-(2,5-dichloroanilino)-1-oxopropan-2-yl] 4-(dimethylamino)benzoate (PubChem CID 8534023) has the molecular formula C18H18Cl2N2O3 and a molecular weight of 381.26 g/mol. Its IUPAC name is [(2R)-1-(2,5-dichloroanilino)-1-oxopropan-2-yl] 4-(dimethylamino)benzoate.
| Compound Name | [(2R)-1-(2,5-dichloroanilino)-1-oxopropan-2-yl] 4-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 8534023 |
| Molecular Formula | C18H18Cl2N2O3 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | [(2R)-1-(2,5-dichloroanilino)-1-oxopropan-2-yl] 4-(dimethylamino)benzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(N(C)C)cc1)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H18Cl2N2O3/c1-11(17(23)21-16-10-13(19)6-9-15(16)20)25-18(24)12-4-7-14(8-5-12)22(2)3/h4-11H,1-3H3,(H,21,23)/t11-/m1/s1 |
| InChIKey | KZYPVXCWDMADBE-LLVKDONJSA-N |
| XLogP | 4.24 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |