C15H11Cl3N2O3 — CID 8017356
[(2S)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate (PubChem CID 8017356) has the molecular formula C15H11Cl3N2O3 and a molecular weight of 373.62 g/mol. Its IUPAC name is [(2S)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate.
| Compound Name | [(2S)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 8017356 |
| Molecular Formula | C15H11Cl3N2O3 |
| Molecular Weight | 373.62 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | [(2S)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate |
| SMILES | C[C@H](OC(=O)c1ccc(Cl)nc1)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H11Cl3N2O3/c1-8(23-15(22)9-2-5-13(18)19-7-9)14(21)20-12-4-3-10(16)6-11(12)17/h2-8H,1H3,(H,20,21)/t8-/m0/s1 |
| InChIKey | VMZZIHKXQOMIPW-QMMMGPOBSA-N |
| XLogP | 4.23 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.62 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|