C16H14ClN3O4 — CID 8017632
[(2R)-1-(4-carbamoylanilino)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate (PubChem CID 8017632) has the molecular formula C16H14ClN3O4 and a molecular weight of 347.76 g/mol. Its IUPAC name is [(2R)-1-(4-carbamoylanilino)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate.
| Compound Name | [(2R)-1-(4-carbamoylanilino)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 8017632 |
| Molecular Formula | C16H14ClN3O4 |
| Molecular Weight | 347.76 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | [(2R)-1-(4-carbamoylanilino)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate |
| SMILES | C[C@@H](OC(=O)c1ccc(Cl)nc1)C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C16H14ClN3O4/c1-9(24-16(23)11-4-7-13(17)19-8-11)15(22)20-12-5-2-10(3-6-12)14(18)21/h2-9H,1H3,(H2,18,21)(H,20,22)/t9-/m1/s1 |
| InChIKey | JODZFZPIRNMDPV-SECBINFHSA-N |
| XLogP | 2.02 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.76 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|