C16H15N3O5 — CID 8792159
[(2S)-1-(4-carbamoylanilino)-1-oxopropan-2-yl] 1-oxidopyridin-1-ium-4-carboxylate (PubChem CID 8792159) has the molecular formula C16H15N3O5 and a molecular weight of 329.31 g/mol. Its IUPAC name is [(2S)-1-(4-carbamoylanilino)-1-oxopropan-2-yl] 1-oxidopyridin-1-ium-4-carboxylate.
| Compound Name | [(2S)-1-(4-carbamoylanilino)-1-oxopropan-2-yl] 1-oxidopyridin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 8792159 |
| Molecular Formula | C16H15N3O5 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | [(2S)-1-(4-carbamoylanilino)-1-oxopropan-2-yl] 1-oxidopyridin-1-ium-4-carboxylate |
| SMILES | C[C@H](OC(=O)c1cc[n+]([O-])cc1)C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C16H15N3O5/c1-10(24-16(22)12-6-8-19(23)9-7-12)15(21)18-13-4-2-11(3-5-13)14(17)20/h2-10H,1H3,(H2,17,20)(H,18,21)/t10-/m0/s1 |
| InChIKey | GFPUHRQCNWVQGL-JTQLQIEISA-N |
| XLogP | 0.60 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|